C17H24O4 — CID 12035097
(1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-(4-methoxyphenyl)cyclohex-3-en-1-ol (PubChem CID 12035097) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-(4-methoxyphenyl)cyclohex-3-en-1-ol.
| Compound Name | (1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-(4-methoxyphenyl)cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 12035097 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-(4-methoxyphenyl)cyclohex-3-en-1-ol |
| SMILES | COC[C@@H]1[C@H](O)[C@H](c2ccc(OC)cc2)C=C[C@@H]1COC |
| InChI | InChI=1S/C17H24O4/c1-19-10-13-6-9-15(17(18)16(13)11-20-2)12-4-7-14(21-3)8-5-12/h4-9,13,15-18H,10-11H2,1-3H3/t13-,15+,16+,17-/m1/s1 |
| InChIKey | NLICCIVGGIHLIZ-BSWAZPDLSA-N |
| XLogP | 2.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|