C20H30O6Si — CID 12036537
methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]oxy-2-phenylacetate (PubChem CID 12036537) has the molecular formula C20H30O6Si and a molecular weight of 394.54 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]oxy-2-phenylacetate.
| Compound Name | methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 12036537 |
| Molecular Formula | C20H30O6Si |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | methyl (2S)-2-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]oxy-2-phenylacetate |
| SMILES | COC(=O)[C@@H](O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1)c1ccccc1 |
| InChI | InChI=1S/C20H30O6Si/c1-20(2,3)27(5,6)26-15-12-16(21)24-17(13-15)25-18(19(22)23-4)14-10-8-7-9-11-14/h7-11,15,17-18H,12-13H2,1-6H3/t15-,17+,18+/m1/s1 |
| InChIKey | NPTPOUDZCHKRCN-NJAFHUGGSA-N |
| XLogP | 3.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|