About 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane
2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane (PubChem CID 12038415) has the molecular formula C13H14F2O
and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane.
Molecular Properties
| Compound Name | 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane |
| PubChem CID | 12038415 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane |
| SMILES | CC(=C(F)F)C1OC1CCc1ccccc1 |
| InChI | InChI=1S/C13H14F2O/c1-9(13(14)15)12-11(16-12)8-7-10-5-3-2-4-6-10/h2-6,11-12H,7-8H2,1H3 |
| InChIKey | NMBDJCZVQMBRGK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane?
The IUPAC name of 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane (CID 12038415) is 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane.
What is the SMILES notation for 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane?
The canonical SMILES for 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane is CC(=C(F)F)C1OC1CCc1ccccc1.
What is the InChIKey of 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane?
The InChIKey is NMBDJCZVQMBRGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O/c1-9(13(14)15)12-11(16-12)8-7-10-5-3-2-4-6-10/h2-6,11-12H,7-8H2,1H3.
What are the key properties of 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane?
2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane has a molecular weight of 224.25 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroprop-1-en-2-yl)-3-(2-phenylethyl)oxirane is sourced from PubChem (CID 12038415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).