C19H20F2O — CID 12038419
(E)-6,6-difluoro-5-methyl-1,6-diphenylhex-4-en-3-ol (PubChem CID 12038419) has the molecular formula C19H20F2O and a molecular weight of 302.36 g/mol. Its IUPAC name is (E)-6,6-difluoro-5-methyl-1,6-diphenylhex-4-en-3-ol.
| Compound Name | (E)-6,6-difluoro-5-methyl-1,6-diphenylhex-4-en-3-ol |
|---|---|
| PubChem CID | 12038419 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (E)-6,6-difluoro-5-methyl-1,6-diphenylhex-4-en-3-ol |
| SMILES | C/C(=C\C(O)CCc1ccccc1)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C19H20F2O/c1-15(19(20,21)17-10-6-3-7-11-17)14-18(22)13-12-16-8-4-2-5-9-16/h2-11,14,18,22H,12-13H2,1H3/b15-14+ |
| InChIKey | TXUXNZAWGDGAFH-CCEZHUSRSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|