C44H51N3O8 — CID 12043139
N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)phenyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 12043139) has the molecular formula C44H51N3O8 and a molecular weight of 749.90 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)phenyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)phenyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 12043139 |
| Molecular Formula | C44H51N3O8 |
| Molecular Weight | 749.90 g/mol |
| Exact Mass | 749.37 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)phenyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | COc1cc(OC)cc(N(Cc2ccccc2-c2cc(OC)c(OC)c(OC)c2)C2CCN(Cc3ccnc(-c4cc(OC)c(OC)c(OC)c4)c3)CC2)c1 |
| InChI | InChI=1S/C44H51N3O8/c1-48-35-24-34(25-36(26-35)49-2)47(28-30-11-9-10-12-37(30)31-20-39(50-3)43(54-7)40(21-31)51-4)33-14-17-46(18-15-33)27-29-13-16-45-38(19-29)32-22-41(52-5)44(55-8)42(23-32)53-6/h9-13,16,19-26,33H,14-15,17-18,27-28H2,1-8H3 |
| InChIKey | USTVITMOGGXJCC-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 93.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.90 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |