C25H23N5O3 — CID 1204393
2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide (PubChem CID 1204393) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1204393 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(3-phenoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(C[C@H]1N=C(Cc2ccccc2)NNC1=O)NN=Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H23N5O3/c31-24(16-22-25(32)30-28-23(27-22)15-18-8-3-1-4-9-18)29-26-17-19-10-7-13-21(14-19)33-20-11-5-2-6-12-20/h1-14,17,22H,15-16H2,(H,27,28)(H,29,31)(H,30,32)/t22-/m1/s1 |
| InChIKey | VWRAJQKYRJVYLM-JOCHJYFZSA-N |
| XLogP | 2.96 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|