C19H18N6O4 — CID 5444123
2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 5444123) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5444123 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[(5R)-3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(C[C@H]1N=C(Cc2ccccc2)NNC1=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N6O4/c26-18(23-20-12-14-6-8-15(9-7-14)25(28)29)11-16-19(27)24-22-17(21-16)10-13-4-2-1-3-5-13/h1-9,12,16H,10-11H2,(H,21,22)(H,23,26)(H,24,27)/b20-12-/t16-/m1/s1 |
| InChIKey | GCBAOYXQHLMONL-SDLDRHLBSA-N |
| XLogP | 1.08 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|