C18H22F2N6O5S — CID 12044277
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-difluorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide (PubChem CID 12044277) has the molecular formula C18H22F2N6O5S and a molecular weight of 472.47 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-difluorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-difluorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 12044277 |
| Molecular Formula | C18H22F2N6O5S |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-[(3,4-difluorophenyl)methylsulfonylamino]-6-methyl-2-oxo-1-pyridinyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)Cc2ccc(F)c(F)c2)c(=O)n1CC(=O)NCCON=C(N)N |
| InChI | InChI=1S/C18H22F2N6O5S/c1-11-2-5-15(25-32(29,30)10-12-3-4-13(19)14(20)8-12)17(28)26(11)9-16(27)23-6-7-31-24-18(21)22/h2-5,8,25H,6-7,9-10H2,1H3,(H,23,27)(H4,21,22,24) |
| InChIKey | ZQVVVLLGJSDETB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|