C17H25N5S — CID 12045492
3-[3-(4-benzylpiperidin-1-yl)propylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 12045492) has the molecular formula C17H25N5S and a molecular weight of 331.49 g/mol. Its IUPAC name is 3-[3-(4-benzylpiperidin-1-yl)propylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[3-(4-benzylpiperidin-1-yl)propylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 12045492 |
| Molecular Formula | C17H25N5S |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-[3-(4-benzylpiperidin-1-yl)propylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(SCCCN2CCC(Cc3ccccc3)CC2)n[nH]1 |
| InChI | InChI=1S/C17H25N5S/c18-16-19-17(21-20-16)23-12-4-9-22-10-7-15(8-11-22)13-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H3,18,19,20,21) |
| InChIKey | UYSXHRGCOVIZLX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|