C27H32N6 — CID 145371932
7-[4-(4-benzylpiperidin-1-yl)-1-phenylbutyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 145371932) has the molecular formula C27H32N6 and a molecular weight of 440.60 g/mol. Its IUPAC name is 7-[4-(4-benzylpiperidin-1-yl)-1-phenylbutyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[4-(4-benzylpiperidin-1-yl)-1-phenylbutyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 145371932 |
| Molecular Formula | C27H32N6 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 7-[4-(4-benzylpiperidin-1-yl)-1-phenylbutyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(C(CCCN2CCC(Cc3ccccc3)CC2)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C27H32N6/c28-25-19-24(26-27(29-25)31-32-30-26)23(22-10-5-2-6-11-22)12-7-15-33-16-13-21(14-17-33)18-20-8-3-1-4-9-20/h1-6,8-11,19,21,23H,7,12-18H2,(H3,28,29,30,31,32) |
| InChIKey | UZMSAZNOWYQYFG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |