C16H19N5 — CID 155112998
7-(5-phenylpentan-2-yl)-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 155112998) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 7-(5-phenylpentan-2-yl)-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-(5-phenylpentan-2-yl)-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 155112998 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 7-(5-phenylpentan-2-yl)-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | CC(CCCc1ccccc1)c1cc(N)nc2n[nH]nc12 |
| InChI | InChI=1S/C16H19N5/c1-11(6-5-9-12-7-3-2-4-8-12)13-10-14(17)18-16-15(13)19-21-20-16/h2-4,7-8,10-11H,5-6,9H2,1H3,(H3,17,18,19,20,21) |
| InChIKey | RIOQBQQBRYWGAK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |