C16H15N5 — CID 126676489
7-(cyclodecapentaenylmethyl)-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 126676489) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 7-(cyclodecapentaenylmethyl)-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-(cyclodecapentaenylmethyl)-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 126676489 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 7-(cyclodecapentaenylmethyl)-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(Cc2ccccccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C16H15N5/c17-14-11-13(15-16(18-14)20-21-19-15)10-12-8-6-4-2-1-3-5-7-9-12/h1-9,11H,10H2,(H3,17,18,19,20,21)/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,9-7-,12-8+,12-9+ |
| InChIKey | JEULKWOQYVWAIH-JOURZZCFSA-N |
| XLogP | 2.65 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |