C7H9N5 — CID 126676575
7-ethyl-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 126676575) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-ethyl-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-ethyl-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 126676575 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 7-ethyl-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | CCc1cc(N)nc2n[nH]nc12 |
| InChI | InChI=1S/C7H9N5/c1-2-4-3-5(8)9-7-6(4)10-12-11-7/h3H,2H2,1H3,(H3,8,9,10,11,12) |
| InChIKey | IPTXXMYIOFHNAU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |