C44H45N9O2 — CID 162262226
1-[3-[(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)methyl]phenyl]-4-phenylbutan-1-one;4-phenyl-1-[3-[(2,3,6-triamino-4-pyridinyl)methyl]phenyl]butan-1-one (PubChem CID 162262226) has the molecular formula C44H45N9O2 and a molecular weight of 731.91 g/mol. Its IUPAC name is 1-[3-[(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)methyl]phenyl]-4-phenylbutan-1-one;4-phenyl-1-[3-[(2,3,6-triamino-4-pyridinyl)methyl]phenyl]butan-1-one.
| Compound Name | 1-[3-[(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)methyl]phenyl]-4-phenylbutan-1-one;4-phenyl-1-[3-[(2,3,6-triamino-4-pyridinyl)methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 162262226 |
| Molecular Formula | C44H45N9O2 |
| Molecular Weight | 731.91 g/mol |
| Exact Mass | 731.37 |
| IUPAC Name | 1-[3-[(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)methyl]phenyl]-4-phenylbutan-1-one;4-phenyl-1-[3-[(2,3,6-triamino-4-pyridinyl)methyl]phenyl]butan-1-one |
| SMILES | Nc1cc(Cc2cccc(C(=O)CCCc3ccccc3)c2)c(N)c(N)n1.Nc1cc(Cc2cccc(C(=O)CCCc3ccccc3)c2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C22H21N5O.C22H24N4O/c23-20-14-18(21-22(24-20)26-27-25-21)13-16-9-4-10-17(12-16)19(28)11-5-8-15-6-2-1-3-7-15;23-20-14-18(21(24)22(25)26-20)13-16-9-4-10-17(12-16)19(27)11-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-10,12,14H,5,8,11,13H2,(H3,23,24,25,26,27);1-4,6-7,9-10,12,14H,5,8,11,13,24H2,(H4,23,25,26) |
| InChIKey | ZZKGBMHKWUQSKW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 205.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.91 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |