C21H21N3O — CID 157197212
1-[3-[(2,6-diamino-4-pyridinyl)methyl]phenyl]-3-phenylpropan-1-one (PubChem CID 157197212) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[3-[(2,6-diamino-4-pyridinyl)methyl]phenyl]-3-phenylpropan-1-one.
| Compound Name | 1-[3-[(2,6-diamino-4-pyridinyl)methyl]phenyl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 157197212 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[3-[(2,6-diamino-4-pyridinyl)methyl]phenyl]-3-phenylpropan-1-one |
| SMILES | Nc1cc(Cc2cccc(C(=O)CCc3ccccc3)c2)cc(N)n1 |
| InChI | InChI=1S/C21H21N3O/c22-20-13-17(14-21(23)24-20)11-16-7-4-8-18(12-16)19(25)10-9-15-5-2-1-3-6-15/h1-8,12-14H,9-11H2,(H4,22,23,24) |
| InChIKey | GUQFDBWARDTMDU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |