C13H12FN5O — CID 126680397
7-[1-(2-fluorophenyl)ethoxy]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 126680397) has the molecular formula C13H12FN5O and a molecular weight of 273.27 g/mol. Its IUPAC name is 7-[1-(2-fluorophenyl)ethoxy]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[1-(2-fluorophenyl)ethoxy]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 126680397 |
| Molecular Formula | C13H12FN5O |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 7-[1-(2-fluorophenyl)ethoxy]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | CC(Oc1cc(N)nc2n[nH]nc12)c1ccccc1F |
| InChI | InChI=1S/C13H12FN5O/c1-7(8-4-2-3-5-9(8)14)20-10-6-11(15)16-13-12(10)17-19-18-13/h2-7H,1H3,(H3,15,16,17,18,19) |
| InChIKey | MCCQXOIFHAJMDZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |