C15H19FN4 — CID 80656756
2-[[1-(2-fluorophenyl)ethyl-methylamino]methyl]-6-methylpyrimidin-4-amine (PubChem CID 80656756) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)ethyl-methylamino]methyl]-6-methylpyrimidin-4-amine.
| Compound Name | 2-[[1-(2-fluorophenyl)ethyl-methylamino]methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80656756 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)ethyl-methylamino]methyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(CN(C)C(C)c2ccccc2F)n1 |
| InChI | InChI=1S/C15H19FN4/c1-10-8-14(17)19-15(18-10)9-20(3)11(2)12-6-4-5-7-13(12)16/h4-8,11H,9H2,1-3H3,(H2,17,18,19) |
| InChIKey | KKSRYCLGUZJWFY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |