C14H17FN4 — CID 80656876
2-[[(2-fluorophenyl)methyl-methylamino]methyl]-6-methylpyrimidin-4-amine (PubChem CID 80656876) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-[[(2-fluorophenyl)methyl-methylamino]methyl]-6-methylpyrimidin-4-amine.
| Compound Name | 2-[[(2-fluorophenyl)methyl-methylamino]methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80656876 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[[(2-fluorophenyl)methyl-methylamino]methyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(CN(C)Cc2ccccc2F)n1 |
| InChI | InChI=1S/C14H17FN4/c1-10-7-13(16)18-14(17-10)9-19(2)8-11-5-3-4-6-12(11)15/h3-7H,8-9H2,1-2H3,(H2,16,17,18) |
| InChIKey | HLWLOYMJFBUADE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |