C33H36N4O4S2 — CID 12049289
4-methyl-N-[2-[C-methyl-N-[3-[1-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethylideneamino]propyl]carbonimidoyl]phenyl]benzenesulfonamide (PubChem CID 12049289) has the molecular formula C33H36N4O4S2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 4-methyl-N-[2-[C-methyl-N-[3-[1-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethylideneamino]propyl]carbonimidoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[C-methyl-N-[3-[1-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethylideneamino]propyl]carbonimidoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 12049289 |
| Molecular Formula | C33H36N4O4S2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 4-methyl-N-[2-[C-methyl-N-[3-[1-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethylideneamino]propyl]carbonimidoyl]phenyl]benzenesulfonamide |
| SMILES | C/C(=N\CCC/N=C(\C)c1ccccc1NS(=O)(=O)c1ccc(C)cc1)c1ccccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H36N4O4S2/c1-24-14-18-28(19-15-24)42(38,39)36-32-12-7-5-10-30(32)26(3)34-22-9-23-35-27(4)31-11-6-8-13-33(31)37-43(40,41)29-20-16-25(2)17-21-29/h5-8,10-21,36-37H,9,22-23H2,1-4H3/b34-26+,35-27+ |
| InChIKey | KNVLPZBURJSJLZ-ZBGIORHCSA-N |
| XLogP | 6.61 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|