C33H42N4O6 — CID 12050257
N-[4-[3-[4-[N-[(3,5-dimethoxyphenyl)methylcarbamoyl]-4-methoxyanilino]piperidin-1-yl]propoxy]phenyl]acetamide (PubChem CID 12050257) has the molecular formula C33H42N4O6 and a molecular weight of 590.72 g/mol. Its IUPAC name is N-[4-[3-[4-[N-[(3,5-dimethoxyphenyl)methylcarbamoyl]-4-methoxyanilino]piperidin-1-yl]propoxy]phenyl]acetamide.
| Compound Name | N-[4-[3-[4-[N-[(3,5-dimethoxyphenyl)methylcarbamoyl]-4-methoxyanilino]piperidin-1-yl]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 12050257 |
| Molecular Formula | C33H42N4O6 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | N-[4-[3-[4-[N-[(3,5-dimethoxyphenyl)methylcarbamoyl]-4-methoxyanilino]piperidin-1-yl]propoxy]phenyl]acetamide |
| SMILES | COc1ccc(N(C(=O)NCc2cc(OC)cc(OC)c2)C2CCN(CCCOc3ccc(NC(C)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H42N4O6/c1-24(38)35-26-6-10-30(11-7-26)43-19-5-16-36-17-14-28(15-18-36)37(27-8-12-29(40-2)13-9-27)33(39)34-23-25-20-31(41-3)22-32(21-25)42-4/h6-13,20-22,28H,5,14-19,23H2,1-4H3,(H,34,39)(H,35,38) |
| InChIKey | CTFNIVPUDTZWDU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|