C17H30Cl2N4O — CID 120503561
3-amino-2-methyl-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide;dihydrochloride (PubChem CID 120503561) has the molecular formula C17H30Cl2N4O and a molecular weight of 377.36 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-2-methyl-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120503561 |
| Molecular Formula | C17H30Cl2N4O |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-amino-2-methyl-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)Nc1ccccc1NC1CCN(C)CC1.Cl.Cl |
| InChI | InChI=1S/C17H28N4O.2ClH/c1-12(13(2)18)17(22)20-16-7-5-4-6-15(16)19-14-8-10-21(3)11-9-14;;/h4-7,12-14,19H,8-11,18H2,1-3H3,(H,20,22);2*1H |
| InChIKey | LGSBBWFGXHMYRO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |