C17H28N4O2 — CID 120596280
4-amino-3-methoxy-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide (PubChem CID 120596280) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 120596280 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 4-amino-3-methoxy-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]butanamide |
| SMILES | COC(CN)CC(=O)Nc1ccccc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-21-9-7-13(8-10-21)19-15-5-3-4-6-16(15)20-17(22)11-14(12-18)23-2/h3-6,13-14,19H,7-12,18H2,1-2H3,(H,20,22) |
| InChIKey | QOTLHMHITCQGOK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |