C14H26Cl2N4O — CID 120503635
3-amino-2-methyl-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]butan-1-one;dihydrochloride (PubChem CID 120503635) has the molecular formula C14H26Cl2N4O and a molecular weight of 337.30 g/mol. Its IUPAC name is 3-amino-2-methyl-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | 3-amino-2-methyl-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120503635 |
| Molecular Formula | C14H26Cl2N4O |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-amino-2-methyl-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]butan-1-one;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)N1CCC(c2ccnn2C)CC1.Cl.Cl |
| InChI | InChI=1S/C14H24N4O.2ClH/c1-10(11(2)15)14(19)18-8-5-12(6-9-18)13-4-7-16-17(13)3;;/h4,7,10-12H,5-6,8-9,15H2,1-3H3;2*1H |
| InChIKey | AMWCRIFDEZQEQB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |