C18H24N4O — CID 124696045
(2R)-3-amino-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-phenylpropan-1-one (PubChem CID 124696045) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (2R)-3-amino-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-phenylpropan-1-one.
| Compound Name | (2R)-3-amino-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 124696045 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2R)-3-amino-1-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-phenylpropan-1-one |
| SMILES | Cn1nccc1C1CCN(C(=O)[C@@H](CN)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N4O/c1-21-17(7-10-20-21)15-8-11-22(12-9-15)18(23)16(13-19)14-5-3-2-4-6-14/h2-7,10,15-16H,8-9,11-13,19H2,1H3/t16-/m0/s1 |
| InChIKey | PKTLTYPHUCLNAI-INIZCTEOSA-N |
| XLogP | 1.87 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |