C18H23N3O3 — CID 97334827
(2R)-2-hydroxy-1-[4-[2-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]-2-phenylethanone (PubChem CID 97334827) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-[4-[2-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]-2-phenylethanone.
| Compound Name | (2R)-2-hydroxy-1-[4-[2-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 97334827 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R)-2-hydroxy-1-[4-[2-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C([C@H](O)c1ccccc1)N1CCC(c2ccnn2CCO)CC1 |
| InChI | InChI=1S/C18H23N3O3/c22-13-12-21-16(6-9-19-21)14-7-10-20(11-8-14)18(24)17(23)15-4-2-1-3-5-15/h1-6,9,14,17,22-23H,7-8,10-13H2/t17-/m1/s1 |
| InChIKey | BOXKWMZHSPWBTI-QGZVFWFLSA-N |
| XLogP | 1.32 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |