C19H23ClN4O4 — CID 120506662
N-[(2S)-1-aminopropan-2-yl]-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride (PubChem CID 120506662) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120506662 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride |
| SMILES | C[C@@H](CN)NC(=O)c1ccccc1C(=O)c1ccc(N(C)C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C19H22N4O4.ClH/c1-12(11-20)21-19(25)15-7-5-4-6-14(15)18(24)13-8-9-16(22(2)3)17(10-13)23(26)27;/h4-10,12H,11,20H2,1-3H3,(H,21,25);1H/t12-;/m0./s1 |
| InChIKey | ZUPLNFQXXVKDAU-YDALLXLXSA-N |
| XLogP | 2.39 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|