C20H25ClN4O4 — CID 119495478
N-(3-aminobutyl)-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride (PubChem CID 119495478) has the molecular formula C20H25ClN4O4 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119495478 |
| Molecular Formula | C20H25ClN4O4 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-(3-aminobutyl)-2-[4-(dimethylamino)-3-nitrobenzoyl]benzamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1ccccc1C(=O)c1ccc(N(C)C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C20H24N4O4.ClH/c1-13(21)10-11-22-20(26)16-7-5-4-6-15(16)19(25)14-8-9-17(23(2)3)18(12-14)24(27)28;/h4-9,12-13H,10-11,21H2,1-3H3,(H,22,26);1H |
| InChIKey | HNRQHKYGOSNFKV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|