C22H24N6O4 — CID 86906390
2-[4-(dimethylamino)-3-nitrobenzoyl]-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 86906390) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3-nitrobenzoyl]-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2-[4-(dimethylamino)-3-nitrobenzoyl]-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 86906390 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[4-(dimethylamino)-3-nitrobenzoyl]-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | CCn1cnnc1CCNC(=O)c1ccccc1C(=O)c1ccc(N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N6O4/c1-4-27-14-24-25-20(27)11-12-23-22(30)17-8-6-5-7-16(17)21(29)15-9-10-18(26(2)3)19(13-15)28(31)32/h5-10,13-14H,4,11-12H2,1-3H3,(H,23,30) |
| InChIKey | ZWQWKBNUHZZFPQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|