C16H24N4O5S — CID 120507992
N-[(2S)-1-aminopropan-2-yl]-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 120507992) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120507992 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)N[C@@H](C)CN)CC1 |
| InChI | InChI=1S/C16H24N4O5S/c1-11-3-4-14(20(22)23)9-15(11)26(24,25)19-7-5-13(6-8-19)16(21)18-12(2)10-17/h3-4,9,12-13H,5-8,10,17H2,1-2H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | PMRNGEOIYBTNBT-LBPRGKRZSA-N |
| XLogP | 0.77 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|