C19H22N4O7S2 — CID 55333442
ethyl 2-[[1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carbonyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 55333442) has the molecular formula C19H22N4O7S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is ethyl 2-[[1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carbonyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carbonyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55333442 |
| Molecular Formula | C19H22N4O7S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | ethyl 2-[[1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carbonyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)C2CCN(S(=O)(=O)c3cc([N+](=O)[O-])ccc3C)CC2)n1 |
| InChI | InChI=1S/C19H22N4O7S2/c1-3-30-18(25)15-11-31-19(20-15)21-17(24)13-6-8-22(9-7-13)32(28,29)16-10-14(23(26)27)5-4-12(16)2/h4-5,10-11,13H,3,6-9H2,1-2H3,(H,20,21,24) |
| InChIKey | RNUAFRIODRNUOD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|