C19H21ClN2O3 — CID 120509484
2-[[3-[(2-chlorobenzoyl)amino]phenyl]methylamino]pentanoic acid (PubChem CID 120509484) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 2-[[3-[(2-chlorobenzoyl)amino]phenyl]methylamino]pentanoic acid.
| Compound Name | 2-[[3-[(2-chlorobenzoyl)amino]phenyl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 120509484 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[[3-[(2-chlorobenzoyl)amino]phenyl]methylamino]pentanoic acid |
| SMILES | CCCC(NCc1cccc(NC(=O)c2ccccc2Cl)c1)C(=O)O |
| InChI | InChI=1S/C19H21ClN2O3/c1-2-6-17(19(24)25)21-12-13-7-5-8-14(11-13)22-18(23)15-9-3-4-10-16(15)20/h3-5,7-11,17,21H,2,6,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | PYCGXHYSTUZOMY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |