C22H20ClFN2O — CID 31563304
2-chloro-N-[3-[[2-(3-fluorophenyl)ethylamino]methyl]phenyl]benzamide (PubChem CID 31563304) has the molecular formula C22H20ClFN2O and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-chloro-N-[3-[[2-(3-fluorophenyl)ethylamino]methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[[2-(3-fluorophenyl)ethylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 31563304 |
| Molecular Formula | C22H20ClFN2O |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-chloro-N-[3-[[2-(3-fluorophenyl)ethylamino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CNCCc2cccc(F)c2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C22H20ClFN2O/c23-21-10-2-1-9-20(21)22(27)26-19-8-4-6-17(14-19)15-25-12-11-16-5-3-7-18(24)13-16/h1-10,13-14,25H,11-12,15H2,(H,26,27) |
| InChIKey | FRVKVERKHGLQPQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|