C22H27NO4 — CID 120509612
4-[(4-methoxy-3-phenylmethoxyphenyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509612) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-[(4-methoxy-3-phenylmethoxyphenyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-methoxy-3-phenylmethoxyphenyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509612 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-[(4-methoxy-3-phenylmethoxyphenyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(CNC2CCC(C(=O)O)CC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO4/c1-26-20-12-7-17(13-21(20)27-15-16-5-3-2-4-6-16)14-23-19-10-8-18(9-11-19)22(24)25/h2-7,12-13,18-19,23H,8-11,14-15H2,1H3,(H,24,25) |
| InChIKey | UDTSQJOJCNQGIZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |