C16H19BrN2O2S — CID 120510162
2-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]methylamino]hexanoic acid (PubChem CID 120510162) has the molecular formula C16H19BrN2O2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 2-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]methylamino]hexanoic acid.
| Compound Name | 2-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120510162 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-[[2-(4-bromophenyl)-1,3-thiazol-5-yl]methylamino]hexanoic acid |
| SMILES | CCCCC(NCc1cnc(-c2ccc(Br)cc2)s1)C(=O)O |
| InChI | InChI=1S/C16H19BrN2O2S/c1-2-3-4-14(16(20)21)18-9-13-10-19-15(22-13)11-5-7-12(17)8-6-11/h5-8,10,14,18H,2-4,9H2,1H3,(H,20,21) |
| InChIKey | UQQZVCUROWBXQM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |