C13H14BrNO4 — CID 120513418
4-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]butanoic acid (PubChem CID 120513418) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120513418 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C1COc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H14BrNO4/c14-8-3-4-11-9(6-8)10(7-19-11)13(18)15-5-1-2-12(16)17/h3-4,6,10H,1-2,5,7H2,(H,15,18)(H,16,17) |
| InChIKey | UWBWIQZICCBILF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|