C16H20BrNO4 — CID 120524046
7-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]heptanoic acid (PubChem CID 120524046) has the molecular formula C16H20BrNO4 and a molecular weight of 370.24 g/mol. Its IUPAC name is 7-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 120524046 |
| Molecular Formula | C16H20BrNO4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 7-[(5-bromo-2,3-dihydro-1-benzofuran-3-carbonyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)C1COc2ccc(Br)cc21 |
| InChI | InChI=1S/C16H20BrNO4/c17-11-6-7-14-12(9-11)13(10-22-14)16(21)18-8-4-2-1-3-5-15(19)20/h6-7,9,13H,1-5,8,10H2,(H,18,21)(H,19,20) |
| InChIKey | NGAXTXFOVYLXLJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|