C10H12N2O4S — CID 120513587
2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]acetic acid (PubChem CID 120513587) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 120513587 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cnc(C2CCCO2)s1 |
| InChI | InChI=1S/C10H12N2O4S/c13-8(14)5-11-9(15)7-4-12-10(17-7)6-2-1-3-16-6/h4,6H,1-3,5H2,(H,11,15)(H,13,14) |
| InChIKey | OBAXDUHDGXXSPP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |