C18H20N2O4S — CID 120519095
2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-phenylbutanoic acid (PubChem CID 120519095) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-phenylbutanoic acid.
| Compound Name | 2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 120519095 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[[2-(oxolan-2-yl)-1,3-thiazole-5-carbonyl]amino]-2-phenylbutanoic acid |
| SMILES | CCC(NC(=O)c1cnc(C2CCCO2)s1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-2-18(17(22)23,12-7-4-3-5-8-12)20-15(21)14-11-19-16(25-14)13-9-6-10-24-13/h3-5,7-8,11,13H,2,6,9-10H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | RWMJOMLTYNEFGF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |