About 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide
2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 120514445) has the molecular formula C9H18F2IN3O
and a molecular weight of 349.16 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| PubChem CID | 120514445 |
| Molecular Formula | C9H18F2IN3O |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/C1CC(F)(F)C1.I |
| InChI | InChI=1S/C9H17F2N3O.HI/c1-6(5-15-2)13-8(12)14-7-3-9(10,11)4-7;/h6-7H,3-5H2,1-2H3,(H3,12,13,14);1H |
| InChIKey | GUJYZOLAAGAKIN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
The IUPAC name of 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (CID 120514445) is 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
What is the SMILES notation for 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
The canonical SMILES for 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide is COCC(C)N/C(N)=N/C1CC(F)(F)C1.I.
What is the InChIKey of 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
The InChIKey is GUJYZOLAAGAKIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N3O.HI/c1-6(5-15-2)13-8(12)14-7-3-9(10,11)4-7;/h6-7H,3-5H2,1-2H3,(H3,12,13,14);1H.
What are the key properties of 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide has a molecular weight of 349.16 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluorocyclobutyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide is sourced from PubChem (CID 120514445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).