C9H15F2N3 — CID 120514536
1-(3,3-difluorocyclobutyl)-2-(2-methylprop-2-enyl)guanidine (PubChem CID 120514536) has the molecular formula C9H15F2N3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-(3,3-difluorocyclobutyl)-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-(3,3-difluorocyclobutyl)-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 120514536 |
| Molecular Formula | C9H15F2N3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1-(3,3-difluorocyclobutyl)-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C9H15F2N3/c1-6(2)5-13-8(12)14-7-3-9(10,11)4-7/h7H,1,3-5H2,2H3,(H3,12,13,14) |
| InChIKey | QFZZWVCRUZUKEN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|