C8H14F3N3 — CID 111800816
2-(2-methylprop-2-enyl)-1-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111800816) has the molecular formula C8H14F3N3 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-(2-methylprop-2-enyl)-1-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111800816 |
| Molecular Formula | C8H14F3N3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3/c1-6(2)5-14-7(12)13-4-3-8(9,10)11/h1,3-5H2,2H3,(H3,12,13,14) |
| InChIKey | FEWZESYILNJWTK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|