C10H17F2N3 — CID 120662420
2-[[1-(difluoromethyl)cyclopropyl]methyl]-1-(2-methylprop-2-enyl)guanidine (PubChem CID 120662420) has the molecular formula C10H17F2N3 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)cyclopropyl]methyl]-1-(2-methylprop-2-enyl)guanidine.
| Compound Name | 2-[[1-(difluoromethyl)cyclopropyl]methyl]-1-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 120662420 |
| Molecular Formula | C10H17F2N3 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-[[1-(difluoromethyl)cyclopropyl]methyl]-1-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(N)=N/CC1(C(F)F)CC1 |
| InChI | InChI=1S/C10H17F2N3/c1-7(2)5-14-9(13)15-6-10(3-4-10)8(11)12/h8H,1,3-6H2,2H3,(H3,13,14,15) |
| InChIKey | VZVAIBKXZXCNCD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|