C22H28N4 — CID 12051576
N-methyl-4-(6-methyl-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline (PubChem CID 12051576) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-methyl-4-(6-methyl-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline.
| Compound Name | N-methyl-4-(6-methyl-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 12051576 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-methyl-4-(6-methyl-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline |
| SMILES | Cc1ccc2nc(-c3ccc(N(C)CCN4CCCCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H28N4/c1-17-6-11-20-21(16-17)24-22(23-20)18-7-9-19(10-8-18)25(2)14-15-26-12-4-3-5-13-26/h6-11,16H,3-5,12-15H2,1-2H3,(H,23,24) |
| InChIKey | LHIKMVYJPPSOTC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|