C28H32N4O — CID 21260449
N-methyl-4-(6-phenylmethoxy-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline (PubChem CID 21260449) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is N-methyl-4-(6-phenylmethoxy-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline.
| Compound Name | N-methyl-4-(6-phenylmethoxy-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 21260449 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N-methyl-4-(6-phenylmethoxy-1H-benzimidazol-2-yl)-N-(2-piperidin-1-ylethyl)aniline |
| SMILES | CN(CCN1CCCCC1)c1ccc(-c2nc3ccc(OCc4ccccc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C28H32N4O/c1-31(18-19-32-16-6-3-7-17-32)24-12-10-23(11-13-24)28-29-26-15-14-25(20-27(26)30-28)33-21-22-8-4-2-5-9-22/h2,4-5,8-15,20H,3,6-7,16-19,21H2,1H3,(H,29,30) |
| InChIKey | IKYRAPINVMLYLN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|