C16H19F2NO3 — CID 120517973
2-[benzyl-(4,4-difluorocyclohexanecarbonyl)amino]acetic acid (PubChem CID 120517973) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[benzyl-(4,4-difluorocyclohexanecarbonyl)amino]acetic acid.
| Compound Name | 2-[benzyl-(4,4-difluorocyclohexanecarbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 120517973 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[benzyl-(4,4-difluorocyclohexanecarbonyl)amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccccc1)C(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H19F2NO3/c17-16(18)8-6-13(7-9-16)15(22)19(11-14(20)21)10-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,20,21) |
| InChIKey | IBFMVGIMXATYRP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |