C17H20N2O3S — CID 120519001
3-(1H-indol-3-yl)-2-(thiane-4-carbonylamino)propanoic acid (PubChem CID 120519001) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-(thiane-4-carbonylamino)propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-(thiane-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 120519001 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-(thiane-4-carbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)C1CCSCC1 |
| InChI | InChI=1S/C17H20N2O3S/c20-16(11-5-7-23-8-6-11)19-15(17(21)22)9-12-10-18-14-4-2-1-3-13(12)14/h1-4,10-11,15,18H,5-9H2,(H,19,20)(H,21,22) |
| InChIKey | LCHNLKRUKAYNPL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |