C20H18F3N3OS2 — CID 1205197
(3R,7aR)-3-[4-(dimethylamino)phenyl]-5-sulfanylidene-6-[3-(trifluoromethyl)phenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one (PubChem CID 1205197) has the molecular formula C20H18F3N3OS2 and a molecular weight of 437.51 g/mol. Its IUPAC name is (3R,7aR)-3-[4-(dimethylamino)phenyl]-5-sulfanylidene-6-[3-(trifluoromethyl)phenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one.
| Compound Name | (3R,7aR)-3-[4-(dimethylamino)phenyl]-5-sulfanylidene-6-[3-(trifluoromethyl)phenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
|---|---|
| PubChem CID | 1205197 |
| Molecular Formula | C20H18F3N3OS2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (3R,7aR)-3-[4-(dimethylamino)phenyl]-5-sulfanylidene-6-[3-(trifluoromethyl)phenyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
| SMILES | CN(C)c1ccc([C@H]2SC[C@H]3C(=O)N(c4cccc(C(F)(F)F)c4)C(=S)N23)cc1 |
| InChI | InChI=1S/C20H18F3N3OS2/c1-24(2)14-8-6-12(7-9-14)18-26-16(11-29-18)17(27)25(19(26)28)15-5-3-4-13(10-15)20(21,22)23/h3-10,16,18H,11H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | ZFCBEQHSYKJPSG-FUHWJXTLSA-N |
| XLogP | 4.52 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|