C19H21FN2O3 — CID 120520504
3-(4-tert-butylphenyl)-3-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid (PubChem CID 120520504) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-3-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-(4-tert-butylphenyl)-3-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 120520504 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-(4-tert-butylphenyl)-3-[(5-fluoropyridine-3-carbonyl)amino]propanoic acid |
| SMILES | CC(C)(C)c1ccc(C(CC(=O)O)NC(=O)c2cncc(F)c2)cc1 |
| InChI | InChI=1S/C19H21FN2O3/c1-19(2,3)14-6-4-12(5-7-14)16(9-17(23)24)22-18(25)13-8-15(20)11-21-10-13/h4-8,10-11,16H,9H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | SYRCZXDYSAFVSH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |