C11H15N3O3S — CID 120524678
2-[3-(thiane-4-carbonylamino)pyrazol-1-yl]acetic acid (PubChem CID 120524678) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[3-(thiane-4-carbonylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-(thiane-4-carbonylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120524678 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[3-(thiane-4-carbonylamino)pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc(NC(=O)C2CCSCC2)n1 |
| InChI | InChI=1S/C11H15N3O3S/c15-10(16)7-14-4-1-9(13-14)12-11(17)8-2-5-18-6-3-8/h1,4,8H,2-3,5-7H2,(H,15,16)(H,12,13,17) |
| InChIKey | ILCHCXZNPFJSSS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |