C12H18N4O5S — CID 119230903
2-[3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]pyrazol-1-yl]acetic acid (PubChem CID 119230903) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119230903 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[3-[(1-methylsulfonylpiperidine-3-carbonyl)amino]pyrazol-1-yl]acetic acid |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)Nc2ccn(CC(=O)O)n2)C1 |
| InChI | InChI=1S/C12H18N4O5S/c1-22(20,21)16-5-2-3-9(7-16)12(19)13-10-4-6-15(14-10)8-11(17)18/h4,6,9H,2-3,5,7-8H2,1H3,(H,17,18)(H,13,14,19) |
| InChIKey | TYAFXAWUADECMO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |